C18H15F3INO2S — CID 18186983
9-[3-iodo-4-(trifluoromethoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one (PubChem CID 18186983) has the molecular formula C18H15F3INO2S and a molecular weight of 493.29 g/mol. Its IUPAC name is 9-[3-iodo-4-(trifluoromethoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one.
| Compound Name | 9-[3-iodo-4-(trifluoromethoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
|---|---|
| PubChem CID | 18186983 |
| Molecular Formula | C18H15F3INO2S |
| Molecular Weight | 493.29 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 9-[3-iodo-4-(trifluoromethoxy)phenyl]-3,4,5,6,7,9-hexahydro-2H-thieno[3,2-b]quinolin-8-one |
| SMILES | O=C1CCCC2=C1C(c1ccc(OC(F)(F)F)c(I)c1)C1=C(CCS1)N2 |
| InChI | InChI=1S/C18H15F3INO2S/c19-18(20,21)25-14-5-4-9(8-10(14)22)15-16-11(2-1-3-13(16)24)23-12-6-7-26-17(12)15/h4-5,8,15,23H,1-3,6-7H2 |
| InChIKey | JDGAZXSUYPQUGW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.29 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|