C27H29NO7S — CID 18188771
[1-methoxy-6-(3-methoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18188771) has the molecular formula C27H29NO7S and a molecular weight of 511.60 g/mol. Its IUPAC name is [1-methoxy-6-(3-methoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [1-methoxy-6-(3-methoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18188771 |
| Molecular Formula | C27H29NO7S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [1-methoxy-6-(3-methoxyphenyl)-2-(2-prop-2-enoxyethoxy)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | C=CCOCCOc1ccc2c(c1OC)-c1ccc(CS(N)(=O)=O)cc1C(c1cccc(OC)c1)O2 |
| InChI | InChI=1S/C27H29NO7S/c1-4-12-33-13-14-34-24-11-10-23-25(27(24)32-3)21-9-8-18(17-36(28,29)30)15-22(21)26(35-23)19-6-5-7-20(16-19)31-2/h4-11,15-16,26H,1,12-14,17H2,2-3H3,(H2,28,29,30) |
| InChIKey | TXSZXKLBHUXPHW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|