C23H21F2NO5S2 — CID 18189059
[1-(difluoromethoxy)-6-[3-(methylsulfanylmethoxy)phenyl]-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18189059) has the molecular formula C23H21F2NO5S2 and a molecular weight of 493.55 g/mol. Its IUPAC name is [1-(difluoromethoxy)-6-[3-(methylsulfanylmethoxy)phenyl]-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [1-(difluoromethoxy)-6-[3-(methylsulfanylmethoxy)phenyl]-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18189059 |
| Molecular Formula | C23H21F2NO5S2 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | [1-(difluoromethoxy)-6-[3-(methylsulfanylmethoxy)phenyl]-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | CSCOc1cccc(C2Oc3cccc(OC(F)F)c3-c3ccc(CS(N)(=O)=O)cc32)c1 |
| InChI | InChI=1S/C23H21F2NO5S2/c1-32-13-29-16-5-2-4-15(11-16)22-18-10-14(12-33(26,27)28)8-9-17(18)21-19(30-22)6-3-7-20(21)31-23(24)25/h2-11,22-23H,12-13H2,1H3,(H2,26,27,28) |
| InChIKey | JGOUGYUVYJHTBE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|