C21H16F3NO4S — CID 18188680
[1-(difluoromethoxy)-6-(3-fluorophenyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18188680) has the molecular formula C21H16F3NO4S and a molecular weight of 435.42 g/mol. Its IUPAC name is [1-(difluoromethoxy)-6-(3-fluorophenyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [1-(difluoromethoxy)-6-(3-fluorophenyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18188680 |
| Molecular Formula | C21H16F3NO4S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | [1-(difluoromethoxy)-6-(3-fluorophenyl)-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc2c(c1)C(c1cccc(F)c1)Oc1cccc(OC(F)F)c1-2 |
| InChI | InChI=1S/C21H16F3NO4S/c22-14-4-1-3-13(10-14)20-16-9-12(11-30(25,26)27)7-8-15(16)19-17(28-20)5-2-6-18(19)29-21(23)24/h1-10,20-21H,11H2,(H2,25,26,27) |
| InChIKey | YCHLQSCLKDYDBU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |