C20H16F2N2O4S — CID 18504013
[1-(difluoromethoxy)-6-pyridin-2-yl-6H-benzo[c]chromen-8-yl]methanesulfonamide (PubChem CID 18504013) has the molecular formula C20H16F2N2O4S and a molecular weight of 418.42 g/mol. Its IUPAC name is [1-(difluoromethoxy)-6-pyridin-2-yl-6H-benzo[c]chromen-8-yl]methanesulfonamide.
| Compound Name | [1-(difluoromethoxy)-6-pyridin-2-yl-6H-benzo[c]chromen-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 18504013 |
| Molecular Formula | C20H16F2N2O4S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [1-(difluoromethoxy)-6-pyridin-2-yl-6H-benzo[c]chromen-8-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc2c(c1)C(c1ccccn1)Oc1cccc(OC(F)F)c1-2 |
| InChI | InChI=1S/C20H16F2N2O4S/c21-20(22)28-17-6-3-5-16-18(17)13-8-7-12(11-29(23,25)26)10-14(13)19(27-16)15-4-1-2-9-24-15/h1-10,19-20H,11H2,(H2,23,25,26) |
| InChIKey | FNTFHPWOPFPYIZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |