C31H37NO6S — CID 18188935
ethyl 6-[3-[1-methoxy-8-(sulfamoylmethyl)-6H-benzo[c]chromen-6-yl]phenyl]-2,2-dimethylhexanoate (PubChem CID 18188935) has the molecular formula C31H37NO6S and a molecular weight of 551.71 g/mol. Its IUPAC name is ethyl 6-[3-[1-methoxy-8-(sulfamoylmethyl)-6H-benzo[c]chromen-6-yl]phenyl]-2,2-dimethylhexanoate.
| Compound Name | ethyl 6-[3-[1-methoxy-8-(sulfamoylmethyl)-6H-benzo[c]chromen-6-yl]phenyl]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 18188935 |
| Molecular Formula | C31H37NO6S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | ethyl 6-[3-[1-methoxy-8-(sulfamoylmethyl)-6H-benzo[c]chromen-6-yl]phenyl]-2,2-dimethylhexanoate |
| SMILES | CCOC(=O)C(C)(C)CCCCc1cccc(C2Oc3cccc(OC)c3-c3ccc(CS(N)(=O)=O)cc32)c1 |
| InChI | InChI=1S/C31H37NO6S/c1-5-37-30(33)31(2,3)17-7-6-10-21-11-8-12-23(18-21)29-25-19-22(20-39(32,34)35)15-16-24(25)28-26(36-4)13-9-14-27(28)38-29/h8-9,11-16,18-19,29H,5-7,10,17,20H2,1-4H3,(H2,32,34,35) |
| InChIKey | QZUNYDKQJRTFAS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|