C19H18O4S — CID 18190579
(2-propanoylphenyl) 3,4-dihydronaphthalene-2-sulfonate (PubChem CID 18190579) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is (2-propanoylphenyl) 3,4-dihydronaphthalene-2-sulfonate.
| Compound Name | (2-propanoylphenyl) 3,4-dihydronaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 18190579 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2-propanoylphenyl) 3,4-dihydronaphthalene-2-sulfonate |
| SMILES | CCC(=O)c1ccccc1OS(=O)(=O)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C19H18O4S/c1-2-18(20)17-9-5-6-10-19(17)23-24(21,22)16-12-11-14-7-3-4-8-15(14)13-16/h3-10,13H,2,11-12H2,1H3 |
| InChIKey | LBAFARZBKZLFKZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|