C16H23N3O5 — CID 18194541
2-[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 18194541) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 18194541 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[3-[2-(cyclohexen-1-yl)ethyl]-2,4,5-trioxoimidazolidin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)C(=O)N(CCC2=CCCCC2)C1=O |
| InChI | InChI=1S/C16H23N3O5/c1-24-10-8-17-13(20)11-19-15(22)14(21)18(16(19)23)9-7-12-5-3-2-4-6-12/h5H,2-4,6-11H2,1H3,(H,17,20) |
| InChIKey | FDXVFVSRWHFYHH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|