C19H18BrNO4S — CID 18197037
[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-bromo-5-methoxybenzoate (PubChem CID 18197037) has the molecular formula C19H18BrNO4S and a molecular weight of 436.33 g/mol. Its IUPAC name is [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-bromo-5-methoxybenzoate.
| Compound Name | [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-bromo-5-methoxybenzoate |
|---|---|
| PubChem CID | 18197037 |
| Molecular Formula | C19H18BrNO4S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-bromo-5-methoxybenzoate |
| SMILES | C=CCSc1ccccc1NC(=O)COC(=O)c1cc(OC)ccc1Br |
| InChI | InChI=1S/C19H18BrNO4S/c1-3-10-26-17-7-5-4-6-16(17)21-18(22)12-25-19(23)14-11-13(24-2)8-9-15(14)20/h3-9,11H,1,10,12H2,2H3,(H,21,22) |
| InChIKey | CMHMFTANIXMXGM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|