C21H22N2O4S — CID 18197236
[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 4-(acetamidomethyl)benzoate (PubChem CID 18197236) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 4-(acetamidomethyl)benzoate.
| Compound Name | [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 18197236 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 4-(acetamidomethyl)benzoate |
| SMILES | C=CCSc1ccccc1NC(=O)COC(=O)c1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C21H22N2O4S/c1-3-12-28-19-7-5-4-6-18(19)23-20(25)14-27-21(26)17-10-8-16(9-11-17)13-22-15(2)24/h3-11H,1,12-14H2,2H3,(H,22,24)(H,23,25) |
| InChIKey | XWBVSPZGHMGJII-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|