C24H24N2O3S — CID 18276425
[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-ethyl-4-methylquinoline-3-carboxylate (PubChem CID 18276425) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-ethyl-4-methylquinoline-3-carboxylate.
| Compound Name | [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18276425 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl] 2-ethyl-4-methylquinoline-3-carboxylate |
| SMILES | C=CCSc1ccccc1NC(=O)COC(=O)c1c(CC)nc2ccccc2c1C |
| InChI | InChI=1S/C24H24N2O3S/c1-4-14-30-21-13-9-8-12-20(21)26-22(27)15-29-24(28)23-16(3)17-10-6-7-11-19(17)25-18(23)5-2/h4,6-13H,1,5,14-15H2,2-3H3,(H,26,27) |
| InChIKey | GCNPXVDRNWYJKM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|