C17H18N4O2S — CID 18199317
(1-phenyltetrazol-5-yl)methyl 5-methyl-4-propylthiophene-2-carboxylate (PubChem CID 18199317) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl)methyl 5-methyl-4-propylthiophene-2-carboxylate.
| Compound Name | (1-phenyltetrazol-5-yl)methyl 5-methyl-4-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 18199317 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (1-phenyltetrazol-5-yl)methyl 5-methyl-4-propylthiophene-2-carboxylate |
| SMILES | CCCc1cc(C(=O)OCc2nnnn2-c2ccccc2)sc1C |
| InChI | InChI=1S/C17H18N4O2S/c1-3-7-13-10-15(24-12(13)2)17(22)23-11-16-18-19-20-21(16)14-8-5-4-6-9-14/h4-6,8-10H,3,7,11H2,1-2H3 |
| InChIKey | JOLKIBNRLHVIEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |