C20H18N2O3S — CID 18203121
3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-6-ethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 18203121) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-6-ethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-6-ethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 18203121 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-6-ethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(Cc3cc(=O)oc4cc(C)c(C)cc34)cnc2s1 |
| InChI | InChI=1S/C20H18N2O3S/c1-4-14-8-16-19(26-14)21-10-22(20(16)24)9-13-7-18(23)25-17-6-12(3)11(2)5-15(13)17/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | BIZRALLOBYXRMI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|