C25H22N2O3S — CID 18204318
phenanthridin-6-ylmethyl 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 18204318) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is phenanthridin-6-ylmethyl 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | phenanthridin-6-ylmethyl 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 18204318 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | phenanthridin-6-ylmethyl 2-acetamido-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(=O)Nc1sc2c(c1C(=O)OCc1nc3ccccc3c3ccccc13)CCCC2 |
| InChI | InChI=1S/C25H22N2O3S/c1-15(28)26-24-23(19-11-5-7-13-22(19)31-24)25(29)30-14-21-18-10-3-2-8-16(18)17-9-4-6-12-20(17)27-21/h2-4,6,8-10,12H,5,7,11,13-14H2,1H3,(H,26,28) |
| InChIKey | HZTSWJVYDQZDPT-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|