C23H21F2NO3S — CID 18204382
[1-(morpholin-4-ylmethyl)naphthalen-2-yl] 2-(3,4-difluorophenyl)sulfanylacetate (PubChem CID 18204382) has the molecular formula C23H21F2NO3S and a molecular weight of 429.49 g/mol. Its IUPAC name is [1-(morpholin-4-ylmethyl)naphthalen-2-yl] 2-(3,4-difluorophenyl)sulfanylacetate.
| Compound Name | [1-(morpholin-4-ylmethyl)naphthalen-2-yl] 2-(3,4-difluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 18204382 |
| Molecular Formula | C23H21F2NO3S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | [1-(morpholin-4-ylmethyl)naphthalen-2-yl] 2-(3,4-difluorophenyl)sulfanylacetate |
| SMILES | O=C(CSc1ccc(F)c(F)c1)Oc1ccc2ccccc2c1CN1CCOCC1 |
| InChI | InChI=1S/C23H21F2NO3S/c24-20-7-6-17(13-21(20)25)30-15-23(27)29-22-8-5-16-3-1-2-4-18(16)19(22)14-26-9-11-28-12-10-26/h1-8,13H,9-12,14-15H2 |
| InChIKey | KUIHAEWXRHGYOC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|