C19H15F2N3O2S — CID 18206147
4-(difluoromethylsulfanyl)-N-[4-(1-methylimidazole-2-carbonyl)phenyl]benzamide (PubChem CID 18206147) has the molecular formula C19H15F2N3O2S and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[4-(1-methylimidazole-2-carbonyl)phenyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[4-(1-methylimidazole-2-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18206147 |
| Molecular Formula | C19H15F2N3O2S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[4-(1-methylimidazole-2-carbonyl)phenyl]benzamide |
| SMILES | Cn1ccnc1C(=O)c1ccc(NC(=O)c2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H15F2N3O2S/c1-24-11-10-22-17(24)16(25)12-2-6-14(7-3-12)23-18(26)13-4-8-15(9-5-13)27-19(20)21/h2-11,19H,1H3,(H,23,26) |
| InChIKey | DXDLVSMTULBZQN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |