C19H23N3O6S — CID 18206343
2-[(4-hydroxycyclohexyl)amino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide (PubChem CID 18206343) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[(4-hydroxycyclohexyl)amino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-[(4-hydroxycyclohexyl)amino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 18206343 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-[(4-hydroxycyclohexyl)amino]-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C19H23N3O6S/c1-28-18-5-3-2-4-16(18)21-29(26,27)19-12-14(22(24)25)8-11-17(19)20-13-6-9-15(23)10-7-13/h2-5,8,11-13,15,20-21,23H,6-7,9-10H2,1H3 |
| InChIKey | ZSALMCYBZZKUSH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|