C33H49N3O5 — CID 18216934
tert-butyl N-[1-[[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-methylbutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18216934) has the molecular formula C33H49N3O5 and a molecular weight of 567.77 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-methylbutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-methylbutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18216934 |
| Molecular Formula | C33H49N3O5 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | tert-butyl N-[1-[[1-(2-hydroxy-3-methylphenyl)-2-oxo-2-(pentylamino)ethyl]-(2-methylbutan-2-yl)amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(c1cccc(C)c1O)N(C(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(C)(C)CC |
| InChI | InChI=1S/C33H49N3O5/c1-9-11-15-21-34-29(38)27(25-20-16-17-23(3)28(25)37)36(33(7,8)10-2)30(39)26(22-24-18-13-12-14-19-24)35-31(40)41-32(4,5)6/h12-14,16-20,26-27,37H,9-11,15,21-22H2,1-8H3,(H,34,38)(H,35,40) |
| InChIKey | WPPXXHSGCHAREX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|