C37H46ClN3O4 — CID 18217179
tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3-ethenylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18217179) has the molecular formula C37H46ClN3O4 and a molecular weight of 632.25 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3-ethenylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3-ethenylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18217179 |
| Molecular Formula | C37H46ClN3O4 |
| Molecular Weight | 632.25 g/mol |
| Exact Mass | 631.32 |
| IUPAC Name | tert-butyl N-[1-[[2-(2-chloro-6-methylanilino)-1-(3-ethenylphenyl)-2-oxoethyl]-hexylamino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)Nc2c(C)cccc2Cl)N(CCCCCC)C(=O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C37H46ClN3O4/c1-7-9-10-14-23-41(35(43)31(25-28-18-12-11-13-19-28)39-36(44)45-37(4,5)6)33(29-21-16-20-27(8-2)24-29)34(42)40-32-26(3)17-15-22-30(32)38/h8,11-13,15-22,24,31,33H,2,7,9-10,14,23,25H2,1,3-6H3,(H,39,44)(H,40,42) |
| InChIKey | DNTBVDYDZHUCBB-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.25 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|