C21H35N9O6 — CID 18243988
2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoic acid (PubChem CID 18243988) has the molecular formula C21H35N9O6 and a molecular weight of 509.57 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18243988 |
| Molecular Formula | C21H35N9O6 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(NC(=O)C1CCCN1C(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C21H35N9O6/c1-11(31)16(20(35)36)29-18(33)15-5-3-7-30(15)19(34)14(8-12-9-25-10-27-12)28-17(32)13(22)4-2-6-26-21(23)24/h9-11,13-16,31H,2-8,22H2,1H3,(H,25,27)(H,28,32)(H,29,33)(H,35,36)(H4,23,24,26) |
| InChIKey | GWRIKORQXHTKEY-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 255.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|