C26H37N9O5 — CID 18498096
2-[[1-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18498096) has the molecular formula C26H37N9O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[1-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18498096 |
| Molecular Formula | C26H37N9O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 2-[[1-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCN1C(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C26H37N9O5/c27-18(13-17-14-30-15-32-17)22(36)34-20(12-16-6-2-1-3-7-16)24(38)35-11-5-9-21(35)23(37)33-19(25(39)40)8-4-10-31-26(28)29/h1-3,6-7,14-15,18-21H,4-5,8-13,27H2,(H,30,32)(H,33,37)(H,34,36)(H,39,40)(H4,28,29,31) |
| InChIKey | ZWAYUIWUUCFVFZ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 234.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|