C23H39N9O5 — CID 22705900
2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22705900) has the molecular formula C23H39N9O5 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22705900 |
| Molecular Formula | C23H39N9O5 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | 2-[[1-[2-[(2-amino-4-methylpentanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H39N9O5/c1-13(2)9-15(24)19(33)31-17(10-14-11-27-12-29-14)21(35)32-8-4-6-18(32)20(34)30-16(22(36)37)5-3-7-28-23(25)26/h11-13,15-18H,3-10,24H2,1-2H3,(H,27,29)(H,30,34)(H,31,33)(H,36,37)(H4,25,26,28) |
| InChIKey | GLAWIQIPZWMWLU-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 234.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|