C22H35N9O7 — CID 18498239
2-[[2-[[1-[2-amino-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 18498239) has the molecular formula C22H35N9O7 and a molecular weight of 537.58 g/mol. Its IUPAC name is 2-[[2-[[1-[2-amino-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[1-[2-amino-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18498239 |
| Molecular Formula | C22H35N9O7 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 2-[[2-[[1-[2-amino-3-(1H-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCCC(NC(=O)C1CCCN1C(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H35N9O7/c23-13(9-12-10-26-11-28-12)20(36)31-8-2-4-16(31)19(35)29-14(3-1-7-27-22(24)25)18(34)30-15(21(37)38)5-6-17(32)33/h10-11,13-16H,1-9,23H2,(H,26,28)(H,29,35)(H,30,34)(H,32,33)(H,37,38)(H4,24,25,27) |
| InChIKey | QHPZDIXQOXYDHD-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 272.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|