C19H31N9O5 — CID 175724182
(2S)-2-[[(2S)-1-[2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175724182) has the molecular formula C19H31N9O5 and a molecular weight of 465.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175724182 |
| Molecular Formula | C19H31N9O5 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (2S)-2-[[(2S)-1-[2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@@H](N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C19H31N9O5/c20-12(7-11-8-23-10-26-11)16(30)25-9-15(29)28-6-2-4-14(28)17(31)27-13(18(32)33)3-1-5-24-19(21)22/h8,10,12-14H,1-7,9,20H2,(H,23,26)(H,25,30)(H,27,31)(H,32,33)(H4,21,22,24)/t12-,13-,14-/m0/s1 |
| InChIKey | MOTVSHWHWFQSNK-IHRRRGAJSA-N |
| XLogP | -2.99 |
| TPSA | 234.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|