C21H24N2O5S — CID 18266953
N'-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-methoxy-4-propoxybenzohydrazide (PubChem CID 18266953) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is N'-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-methoxy-4-propoxybenzohydrazide.
| Compound Name | N'-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-methoxy-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 18266953 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N'-(3,4-dihydronaphthalen-2-ylsulfonyl)-3-methoxy-4-propoxybenzohydrazide |
| SMILES | CCCOc1ccc(C(=O)NNS(=O)(=O)C2=Cc3ccccc3CC2)cc1OC |
| InChI | InChI=1S/C21H24N2O5S/c1-3-12-28-19-11-9-17(14-20(19)27-2)21(24)22-23-29(25,26)18-10-8-15-6-4-5-7-16(15)13-18/h4-7,9,11,13-14,23H,3,8,10,12H2,1-2H3,(H,22,24) |
| InChIKey | IGBPQMWWMYRTJF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|