C18H14ClN3O7 — CID 18271866
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate (PubChem CID 18271866) has the molecular formula C18H14ClN3O7 and a molecular weight of 419.78 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate |
|---|---|
| PubChem CID | 18271866 |
| Molecular Formula | C18H14ClN3O7 |
| Molecular Weight | 419.78 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(3-oxo-4H-1,4-benzoxazin-2-yl)acetate |
| SMILES | O=C(COC(=O)CC1Oc2ccccc2NC1=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H14ClN3O7/c19-11-7-10(22(26)27)5-6-12(11)20-16(23)9-28-17(24)8-15-18(25)21-13-3-1-2-4-14(13)29-15/h1-7,15H,8-9H2,(H,20,23)(H,21,25) |
| InChIKey | XHVPVUVGQYDEAW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.78 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|