C19H15N5OS — CID 18275464
N-(3-benzyl-1,3-thiazol-2-ylidene)-2-phenyltriazole-4-carboxamide (PubChem CID 18275464) has the molecular formula C19H15N5OS and a molecular weight of 361.43 g/mol. Its IUPAC name is N-(3-benzyl-1,3-thiazol-2-ylidene)-2-phenyltriazole-4-carboxamide.
| Compound Name | N-(3-benzyl-1,3-thiazol-2-ylidene)-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 18275464 |
| Molecular Formula | C19H15N5OS |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(3-benzyl-1,3-thiazol-2-ylidene)-2-phenyltriazole-4-carboxamide |
| SMILES | O=C(/N=c1\sccn1Cc1ccccc1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H15N5OS/c25-18(17-13-20-24(22-17)16-9-5-2-6-10-16)21-19-23(11-12-26-19)14-15-7-3-1-4-8-15/h1-13H,14H2/b21-19- |
| InChIKey | MQEJSSDYPOBGMJ-VZCXRCSSSA-N |
| XLogP | 2.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |