C22H21N3O4S — CID 38486353
N-(3-benzyl-1,3-thiazol-2-ylidene)-4,6,7-trimethoxy-1H-indole-2-carboxamide (PubChem CID 38486353) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-(3-benzyl-1,3-thiazol-2-ylidene)-4,6,7-trimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-(3-benzyl-1,3-thiazol-2-ylidene)-4,6,7-trimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 38486353 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-(3-benzyl-1,3-thiazol-2-ylidene)-4,6,7-trimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc(OC)c2cc(C(=O)/N=c3\sccn3Cc3ccccc3)[nH]c2c1OC |
| InChI | InChI=1S/C22H21N3O4S/c1-27-17-12-18(28-2)20(29-3)19-15(17)11-16(23-19)21(26)24-22-25(9-10-30-22)13-14-7-5-4-6-8-14/h4-12,23H,13H2,1-3H3/b24-22- |
| InChIKey | UJRJGEUBUSGVFC-GYHWCHFESA-N |
| XLogP | 3.85 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |