C19H16N4O5S — CID 18275849
1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 18275849) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 18275849 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)ethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | CC(OC(=O)c1ccccc1CN1C(=O)CNC1=O)c1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C19H16N4O5S/c1-11(16-21-22-17(28-16)14-7-4-8-29-14)27-18(25)13-6-3-2-5-12(13)10-23-15(24)9-20-19(23)26/h2-8,11H,9-10H2,1H3,(H,20,26) |
| InChIKey | XWOKBYSGQKRVDM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|