C20H15N5 — CID 18276652
6-[(2-methyl-1-phenylbenzimidazol-5-yl)amino]pyridine-3-carbonitrile (PubChem CID 18276652) has the molecular formula C20H15N5 and a molecular weight of 325.38 g/mol. Its IUPAC name is 6-[(2-methyl-1-phenylbenzimidazol-5-yl)amino]pyridine-3-carbonitrile.
| Compound Name | 6-[(2-methyl-1-phenylbenzimidazol-5-yl)amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 18276652 |
| Molecular Formula | C20H15N5 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 6-[(2-methyl-1-phenylbenzimidazol-5-yl)amino]pyridine-3-carbonitrile |
| SMILES | Cc1nc2cc(Nc3ccc(C#N)cn3)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C20H15N5/c1-14-23-18-11-16(24-20-10-7-15(12-21)13-22-20)8-9-19(18)25(14)17-5-3-2-4-6-17/h2-11,13H,1H3,(H,22,24) |
| InChIKey | YPMPSAYGJOBKCZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |