C19H14N6 — CID 154795798
2-methyl-6-[(1-phenylbenzimidazol-5-yl)amino]pyrimidine-4-carbonitrile (PubChem CID 154795798) has the molecular formula C19H14N6 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-methyl-6-[(1-phenylbenzimidazol-5-yl)amino]pyrimidine-4-carbonitrile.
| Compound Name | 2-methyl-6-[(1-phenylbenzimidazol-5-yl)amino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 154795798 |
| Molecular Formula | C19H14N6 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-methyl-6-[(1-phenylbenzimidazol-5-yl)amino]pyrimidine-4-carbonitrile |
| SMILES | Cc1nc(C#N)cc(Nc2ccc3c(c2)ncn3-c2ccccc2)n1 |
| InChI | InChI=1S/C19H14N6/c1-13-22-15(11-20)10-19(23-13)24-14-7-8-18-17(9-14)21-12-25(18)16-5-3-2-4-6-16/h2-10,12H,1H3,(H,22,23,24) |
| InChIKey | CPYJUZXRHXXTIM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |