C23H26N2O3S — CID 18277480
3-(1,3-benzodioxol-5-yl)-1-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]propan-1-one (PubChem CID 18277480) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]propan-1-one |
|---|---|
| PubChem CID | 18277480 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[2-(2-propan-2-ylphenyl)imino-1,3-thiazinan-3-yl]propan-1-one |
| SMILES | CC(C)c1ccccc1/N=C1\SCCCN1C(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H26N2O3S/c1-16(2)18-6-3-4-7-19(18)24-23-25(12-5-13-29-23)22(26)11-9-17-8-10-20-21(14-17)28-15-27-20/h3-4,6-8,10,14,16H,5,9,11-13,15H2,1-2H3/b24-23- |
| InChIKey | AYRMTJFTBFUARH-VHXPQNKSSA-N |
| XLogP | 5.12 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|