C18H27N5O4 — CID 18278896
2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-5-piperidin-1-ylbenzamide (PubChem CID 18278896) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-5-piperidin-1-ylbenzamide.
| Compound Name | 2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-5-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 18278896 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]-5-piperidin-1-ylbenzamide |
| SMILES | COCCNC(=O)NC(=O)CNc1ccc(N2CCCCC2)cc1C(N)=O |
| InChI | InChI=1S/C18H27N5O4/c1-27-10-7-20-18(26)22-16(24)12-21-15-6-5-13(11-14(15)17(19)25)23-8-3-2-4-9-23/h5-6,11,21H,2-4,7-10,12H2,1H3,(H2,19,25)(H2,20,22,24,26) |
| InChIKey | MXVJZELNRIUSRZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|