C22H33N3O — CID 18281034
N-(1-cyanocyclohexyl)-N-methyl-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]propanamide (PubChem CID 18281034) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-N-methyl-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]propanamide.
| Compound Name | N-(1-cyanocyclohexyl)-N-methyl-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 18281034 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | N-(1-cyanocyclohexyl)-N-methyl-2-[methyl-[(4-propan-2-ylphenyl)methyl]amino]propanamide |
| SMILES | CC(C)c1ccc(CN(C)C(C)C(=O)N(C)C2(C#N)CCCCC2)cc1 |
| InChI | InChI=1S/C22H33N3O/c1-17(2)20-11-9-19(10-12-20)15-24(4)18(3)21(26)25(5)22(16-23)13-7-6-8-14-22/h9-12,17-18H,6-8,13-15H2,1-5H3 |
| InChIKey | MODBTAIYTNYTCL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |