C19H15ClN2O2 — CID 18284203
N-(3-chloro-4-cyanophenyl)-2-(5,6-dimethyl-1-benzofuran-3-yl)acetamide (PubChem CID 18284203) has the molecular formula C19H15ClN2O2 and a molecular weight of 338.79 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(5,6-dimethyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(5,6-dimethyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18284203 |
| Molecular Formula | C19H15ClN2O2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(5,6-dimethyl-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1cc2occ(CC(=O)Nc3ccc(C#N)c(Cl)c3)c2cc1C |
| InChI | InChI=1S/C19H15ClN2O2/c1-11-5-16-14(10-24-18(16)6-12(11)2)7-19(23)22-15-4-3-13(9-21)17(20)8-15/h3-6,8,10H,7H2,1-2H3,(H,22,23) |
| InChIKey | ACGSJGQHJSWOFJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |