C18H16FNOS — CID 18284496
(E)-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 18284496) has the molecular formula C18H16FNOS and a molecular weight of 313.40 g/mol. Its IUPAC name is (E)-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18284496 |
| Molecular Formula | C18H16FNOS |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (E)-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-3-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N1CCCSc2ccccc21 |
| InChI | InChI=1S/C18H16FNOS/c19-15-9-6-14(7-10-15)8-11-18(21)20-12-3-13-22-17-5-2-1-4-16(17)20/h1-2,4-11H,3,12-13H2/b11-8+ |
| InChIKey | BJGROFHPNFNVHY-DHZHZOJOSA-N |
| XLogP | 4.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|