C19H17F2NO2S — CID 18289970
(E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)prop-2-en-1-one (PubChem CID 18289970) has the molecular formula C19H17F2NO2S and a molecular weight of 361.41 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18289970 |
| Molecular Formula | C19H17F2NO2S |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-1-(3,4-dihydro-2H-1,5-benzothiazepin-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)N1CCCSc2ccccc21 |
| InChI | InChI=1S/C19H17F2NO2S/c20-19(21)24-15-9-6-14(7-10-15)8-11-18(23)22-12-3-13-25-17-5-2-1-4-16(17)22/h1-2,4-11,19H,3,12-13H2/b11-8+ |
| InChIKey | AIQOIGLZPRVRIP-DHZHZOJOSA-N |
| XLogP | 4.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|