C18H28N4O4S2 — CID 18285965
3-[5-butylsulfanyl-4-(2,2-dimethoxyethyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 18285965) has the molecular formula C18H28N4O4S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-[5-butylsulfanyl-4-(2,2-dimethoxyethyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[5-butylsulfanyl-4-(2,2-dimethoxyethyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 18285965 |
| Molecular Formula | C18H28N4O4S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-[5-butylsulfanyl-4-(2,2-dimethoxyethyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CCCCSc1nnc(-c2cccc(S(=O)(=O)N(C)C)c2)n1CC(OC)OC |
| InChI | InChI=1S/C18H28N4O4S2/c1-6-7-11-27-18-20-19-17(22(18)13-16(25-4)26-5)14-9-8-10-15(12-14)28(23,24)21(2)3/h8-10,12,16H,6-7,11,13H2,1-5H3 |
| InChIKey | YMQWBOSOFMEJFO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|