C18H26N4O4S2 — CID 55314504
3-[4-(2,2-dimethoxyethyl)-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 55314504) has the molecular formula C18H26N4O4S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-[4-(2,2-dimethoxyethyl)-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[4-(2,2-dimethoxyethyl)-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55314504 |
| Molecular Formula | C18H26N4O4S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-[4-(2,2-dimethoxyethyl)-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-3-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | C=C(C)CSc1nnc(-c2cccc(S(=O)(=O)N(C)C)c2)n1CC(OC)OC |
| InChI | InChI=1S/C18H26N4O4S2/c1-13(2)12-27-18-20-19-17(22(18)11-16(25-5)26-6)14-8-7-9-15(10-14)28(23,24)21(3)4/h7-10,16H,1,11-12H2,2-6H3 |
| InChIKey | LDCLRNSKLRZHOI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|