C17H28N6O4S3 — CID 56506971
3-[4-amino-5-[3-(dimethylsulfamoyl)propylsulfanyl]-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 56506971) has the molecular formula C17H28N6O4S3 and a molecular weight of 476.65 g/mol. Its IUPAC name is 3-[4-amino-5-[3-(dimethylsulfamoyl)propylsulfanyl]-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[4-amino-5-[3-(dimethylsulfamoyl)propylsulfanyl]-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 56506971 |
| Molecular Formula | C17H28N6O4S3 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 3-[4-amino-5-[3-(dimethylsulfamoyl)propylsulfanyl]-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCCS(=O)(=O)N(C)C)n2N)c1 |
| InChI | InChI=1S/C17H28N6O4S3/c1-5-22(6-2)30(26,27)15-10-7-9-14(13-15)16-19-20-17(23(16)18)28-11-8-12-29(24,25)21(3)4/h7,9-10,13H,5-6,8,11-12,18H2,1-4H3 |
| InChIKey | WQBLFNKEDDXKMY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|