C21H32N6O3S2 — CID 2390976
3-[4-amino-5-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 2390976) has the molecular formula C21H32N6O3S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 3-[4-amino-5-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[4-amino-5-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2390976 |
| Molecular Formula | C21H32N6O3S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[4-amino-5-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCC(=O)N3[C@H](C)CCC[C@H]3C)n2N)c1 |
| InChI | InChI=1S/C21H32N6O3S2/c1-5-25(6-2)32(29,30)18-12-8-11-17(13-18)20-23-24-21(27(20)22)31-14-19(28)26-15(3)9-7-10-16(26)4/h8,11-13,15-16H,5-7,9-10,14,22H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | WISBLEFEOXBZLA-HZPDHXFCSA-N |
| XLogP | 2.57 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |