C15H20N6O2S2 — CID 33278982
3-[4-amino-5-(2-cyanoethylsulfanyl)-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide (PubChem CID 33278982) has the molecular formula C15H20N6O2S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is 3-[4-amino-5-(2-cyanoethylsulfanyl)-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 3-[4-amino-5-(2-cyanoethylsulfanyl)-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 33278982 |
| Molecular Formula | C15H20N6O2S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-[4-amino-5-(2-cyanoethylsulfanyl)-1,2,4-triazol-3-yl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2nnc(SCCC#N)n2N)c1 |
| InChI | InChI=1S/C15H20N6O2S2/c1-3-20(4-2)25(22,23)13-8-5-7-12(11-13)14-18-19-15(21(14)17)24-10-6-9-16/h5,7-8,11H,3-4,6,10,17H2,1-2H3 |
| InChIKey | HJBLMQXEXSCJDP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|