C21H36N2O — CID 18289341
2-[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 18289341) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is 2-[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 18289341 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 2-[[1-(4-tert-butylphenyl)-2-methylpropyl]amino]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)CNC(c1ccc(C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C21H36N2O/c1-9-21(7,8)23-18(24)14-22-19(15(2)3)16-10-12-17(13-11-16)20(4,5)6/h10-13,15,19,22H,9,14H2,1-8H3,(H,23,24) |
| InChIKey | RGZRHEKQNQXURT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |