C24H23F2NO2S — CID 18290907
2-(2-benzhydryloxyethylsulfanyl)-N-(2,4-difluorophenyl)propanamide (PubChem CID 18290907) has the molecular formula C24H23F2NO2S and a molecular weight of 427.52 g/mol. Its IUPAC name is 2-(2-benzhydryloxyethylsulfanyl)-N-(2,4-difluorophenyl)propanamide.
| Compound Name | 2-(2-benzhydryloxyethylsulfanyl)-N-(2,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 18290907 |
| Molecular Formula | C24H23F2NO2S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-(2-benzhydryloxyethylsulfanyl)-N-(2,4-difluorophenyl)propanamide |
| SMILES | CC(SCCOC(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C24H23F2NO2S/c1-17(24(28)27-22-13-12-20(25)16-21(22)26)30-15-14-29-23(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-13,16-17,23H,14-15H2,1H3,(H,27,28) |
| InChIKey | LVZJFVGPHYOYKO-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|