C19H20N4O4 — CID 18292837
N-(1-acetyl-2,3-dihydroindol-5-yl)-2-(dimethylamino)-5-nitrobenzamide (PubChem CID 18292837) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-2-(dimethylamino)-5-nitrobenzamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-(dimethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 18292837 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-(dimethylamino)-5-nitrobenzamide |
| SMILES | CC(=O)N1CCc2cc(NC(=O)c3cc([N+](=O)[O-])ccc3N(C)C)ccc21 |
| InChI | InChI=1S/C19H20N4O4/c1-12(24)22-9-8-13-10-14(4-6-17(13)22)20-19(25)16-11-15(23(26)27)5-7-18(16)21(2)3/h4-7,10-11H,8-9H2,1-3H3,(H,20,25) |
| InChIKey | XWLKOUAVXYVKEW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|