C26H18N2O4 — CID 18293252
methyl 2-[(4-cyanobenzoyl)oxymethyl]-4-phenylquinoline-3-carboxylate (PubChem CID 18293252) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 2-[(4-cyanobenzoyl)oxymethyl]-4-phenylquinoline-3-carboxylate.
| Compound Name | methyl 2-[(4-cyanobenzoyl)oxymethyl]-4-phenylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18293252 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | methyl 2-[(4-cyanobenzoyl)oxymethyl]-4-phenylquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(COC(=O)c2ccc(C#N)cc2)nc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C26H18N2O4/c1-31-26(30)24-22(16-32-25(29)19-13-11-17(15-27)12-14-19)28-21-10-6-5-9-20(21)23(24)18-7-3-2-4-8-18/h2-14H,16H2,1H3 |
| InChIKey | BHYIYICSGQDGDG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |