C38H33I2N4O2Rh — CID 18293359
diiodorhodium(1+);1-methyl-3-[1-[2-(3-methyl-2H-benzimidazol-1-yl)naphthalen-1-yl]naphthalen-2-yl]-2H-benzimidazole;acetate (PubChem CID 18293359) has the molecular formula C38H33I2N4O2Rh and a molecular weight of 934.42 g/mol. Its IUPAC name is diiodorhodium(1+);1-methyl-3-[1-[2-(3-methyl-2H-benzimidazol-1-yl)naphthalen-1-yl]naphthalen-2-yl]-2H-benzimidazole;acetate.
| Compound Name | diiodorhodium(1+);1-methyl-3-[1-[2-(3-methyl-2H-benzimidazol-1-yl)naphthalen-1-yl]naphthalen-2-yl]-2H-benzimidazole;acetate |
|---|---|
| PubChem CID | 18293359 |
| Molecular Formula | C38H33I2N4O2Rh |
| Molecular Weight | 934.42 g/mol |
| Exact Mass | 933.97 |
| IUPAC Name | diiodorhodium(1+);1-methyl-3-[1-[2-(3-methyl-2H-benzimidazol-1-yl)naphthalen-1-yl]naphthalen-2-yl]-2H-benzimidazole;acetate |
| SMILES | CC(=O)[O-].CN1CN(c2ccc3ccccc3c2-c2c(N3CN(C)c4ccccc43)ccc3ccccc23)c2ccccc21.I[Rh+]I |
| InChI | InChI=1S/C36H30N4.C2H4O2.2HI.Rh/c1-37-23-39(31-17-9-7-15-29(31)37)33-21-19-25-11-3-5-13-27(25)35(33)36-28-14-6-4-12-26(28)20-22-34(36)40-24-38(2)30-16-8-10-18-32(30)40;1-2(3)4;;;/h3-22H,23-24H2,1-2H3;1H3,(H,3,4);2*1H;/q;;;;+3/p-3 |
| InChIKey | LLPPTCVCBGXZBX-UHFFFAOYSA-K |
| XLogP | 9.28 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.42 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|