C17H33N5O5 — CID 18295940
2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]acetyl]amino]propanoic acid (PubChem CID 18295940) has the molecular formula C17H33N5O5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]acetyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18295940 |
| Molecular Formula | C17H33N5O5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-methylpentanoyl)amino]hexanoyl]amino]acetyl]amino]propanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CCCCN)C(=O)NCC(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C17H33N5O5/c1-4-10(2)14(19)16(25)22-12(7-5-6-8-18)15(24)20-9-13(23)21-11(3)17(26)27/h10-12,14H,4-9,18-19H2,1-3H3,(H,20,24)(H,21,23)(H,22,25)(H,26,27) |
| InChIKey | FQYDHPHUTUBAAY-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|