C21H37N5O9 — CID 18298808
2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid (PubChem CID 18298808) has the molecular formula C21H37N5O9 and a molecular weight of 503.55 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18298808 |
| Molecular Formula | C21H37N5O9 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H37N5O9/c1-11(2)9-12(23)18(31)24-13(5-3-4-8-22)19(32)26-15(10-17(29)30)20(33)25-14(21(34)35)6-7-16(27)28/h11-15H,3-10,22-23H2,1-2H3,(H,24,31)(H,25,33)(H,26,32)(H,27,28)(H,29,30)(H,34,35) |
| InChIKey | MPNCDTPATDVPNE-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|