C24H48N8O5 — CID 18298924
2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18298924) has the molecular formula C24H48N8O5 and a molecular weight of 528.70 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18298924 |
| Molecular Formula | C24H48N8O5 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CC(C)C)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H48N8O5/c1-5-15(4)19(22(35)31-18(23(36)37)10-8-12-29-24(27)28)32-21(34)17(9-6-7-11-25)30-20(33)16(26)13-14(2)3/h14-19H,5-13,25-26H2,1-4H3,(H,30,33)(H,31,35)(H,32,34)(H,36,37)(H4,27,28,29) |
| InChIKey | ZEKRYURIEHGZHA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 241.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|